C12H14N2O3 — CID 156712076
3-[5-oxo-3-[(Z)-prop-1-enyl]-2H-pyrrol-1-yl]piperidine-2,6-dione (PubChem CID 156712076) has the molecular formula C12H14N2O3 and a molecular weight of 234.25 g/mol. Its IUPAC name is 3-[5-oxo-3-[(Z)-prop-1-enyl]-2H-pyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-oxo-3-[(Z)-prop-1-enyl]-2H-pyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156712076 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 3-[5-oxo-3-[(Z)-prop-1-enyl]-2H-pyrrol-1-yl]piperidine-2,6-dione |
| SMILES | C/C=C\C1=CC(=O)N(C2CCC(=O)NC2=O)C1 |
| InChI | InChI=1S/C12H14N2O3/c1-2-3-8-6-11(16)14(7-8)9-4-5-10(15)13-12(9)17/h2-3,6,9H,4-5,7H2,1H3,(H,13,15,17)/b3-2- |
| InChIKey | VCOJGXMXHJIADI-IHWYPQMZSA-N |
| XLogP | 0.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|