C20H32N2O3 — CID 176987678
ethane;3-[7-ethyl-4-oxo-6-[(Z)-prop-1-enyl]-5-azaspiro[2.4]hept-6-en-5-yl]piperidine-2,6-dione (PubChem CID 176987678) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is ethane;3-[7-ethyl-4-oxo-6-[(Z)-prop-1-enyl]-5-azaspiro[2.4]hept-6-en-5-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[7-ethyl-4-oxo-6-[(Z)-prop-1-enyl]-5-azaspiro[2.4]hept-6-en-5-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176987678 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | ethane;3-[7-ethyl-4-oxo-6-[(Z)-prop-1-enyl]-5-azaspiro[2.4]hept-6-en-5-yl]piperidine-2,6-dione |
| SMILES | C/C=C\C1=C(CC)C2(CC2)C(=O)N1C1CCC(=O)NC1=O.CC.CC |
| InChI | InChI=1S/C16H20N2O3.2C2H6/c1-3-5-11-10(4-2)16(8-9-16)15(21)18(11)12-6-7-13(19)17-14(12)20;2*1-2/h3,5,12H,4,6-9H2,1-2H3,(H,17,19,20);2*1-2H3/b5-3-;; |
| InChIKey | VBMOLBXFPWRSNI-ORIPCLHRSA-N |
| XLogP | 3.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|