C15H13BN2O3 — CID 178005333
CID 178005333 (PubChem CID 178005333) has the molecular formula C15H13BN2O3 and a molecular weight of 280.09 g/mol.
| Compound Name | CID 178005333 |
|---|---|
| PubChem CID | 178005333 |
| Molecular Formula | C15H13BN2O3 |
| Molecular Weight | 280.09 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2c1C1(CC1)C(=O)N2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C15H13BN2O3/c16-8-2-1-3-9-12(8)15(6-7-15)14(21)18(9)10-4-5-11(19)17-13(10)20/h1-3,10H,4-7H2,(H,17,19,20) |
| InChIKey | UKXXDLLBNDHCJD-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.09 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|