C25H26N4O3 — CID 171618731
3-(2'-oxo-5-piperazin-1-ylspiro[1,3-dihydroindene-2,3'-indole]-1'-yl)piperidine-2,6-dione (PubChem CID 171618731) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-(2'-oxo-5-piperazin-1-ylspiro[1,3-dihydroindene-2,3'-indole]-1'-yl)piperidine-2,6-dione.
| Compound Name | 3-(2'-oxo-5-piperazin-1-ylspiro[1,3-dihydroindene-2,3'-indole]-1'-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 171618731 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-(2'-oxo-5-piperazin-1-ylspiro[1,3-dihydroindene-2,3'-indole]-1'-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)C3(Cc4ccc(N5CCNCC5)cc4C3)c3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C25H26N4O3/c30-22-8-7-21(23(31)27-22)29-20-4-2-1-3-19(20)25(24(29)32)14-16-5-6-18(13-17(16)15-25)28-11-9-26-10-12-28/h1-6,13,21,26H,7-12,14-15H2,(H,27,30,31) |
| InChIKey | YSVHBZFGHYDSFP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|