C17H23N5O3 — CID 167470171
3-(2-hydroxy-3-methyl-5-piperazin-1-yl-2H-benzimidazol-1-yl)piperidine-2,6-dione (PubChem CID 167470171) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-(2-hydroxy-3-methyl-5-piperazin-1-yl-2H-benzimidazol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(2-hydroxy-3-methyl-5-piperazin-1-yl-2H-benzimidazol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167470171 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 3-(2-hydroxy-3-methyl-5-piperazin-1-yl-2H-benzimidazol-1-yl)piperidine-2,6-dione |
| SMILES | CN1c2cc(N3CCNCC3)ccc2N(C2CCC(=O)NC2=O)C1O |
| InChI | InChI=1S/C17H23N5O3/c1-20-14-10-11(21-8-6-18-7-9-21)2-3-12(14)22(17(20)25)13-4-5-15(23)19-16(13)24/h2-3,10,13,17-18,25H,4-9H2,1H3,(H,19,23,24) |
| InChIKey | WAQHDRIWZFOTGQ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|