C32H39N5O5 — CID 166753156
tert-butyl N-[4-[[4-[2-[1-(2,6-dioxopiperidin-3-yl)-2-hydroxy-3-methyl-2H-benzimidazol-5-yl]ethynyl]piperidin-1-yl]methyl]phenyl]carbamate (PubChem CID 166753156) has the molecular formula C32H39N5O5 and a molecular weight of 573.69 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-[2-[1-(2,6-dioxopiperidin-3-yl)-2-hydroxy-3-methyl-2H-benzimidazol-5-yl]ethynyl]piperidin-1-yl]methyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-[2-[1-(2,6-dioxopiperidin-3-yl)-2-hydroxy-3-methyl-2H-benzimidazol-5-yl]ethynyl]piperidin-1-yl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 166753156 |
| Molecular Formula | C32H39N5O5 |
| Molecular Weight | 573.69 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | tert-butyl N-[4-[[4-[2-[1-(2,6-dioxopiperidin-3-yl)-2-hydroxy-3-methyl-2H-benzimidazol-5-yl]ethynyl]piperidin-1-yl]methyl]phenyl]carbamate |
| SMILES | CN1c2cc(C#CC3CCN(Cc4ccc(NC(=O)OC(C)(C)C)cc4)CC3)ccc2N(C2CCC(=O)NC2=O)C1O |
| InChI | InChI=1S/C32H39N5O5/c1-32(2,3)42-30(40)33-24-10-7-23(8-11-24)20-36-17-15-21(16-18-36)5-6-22-9-12-25-27(19-22)35(4)31(41)37(25)26-13-14-28(38)34-29(26)39/h7-12,19,21,26,31,41H,13-18,20H2,1-4H3,(H,33,40)(H,34,38,39) |
| InChIKey | HQAMZSYYUNTVJR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.69 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|