C32H41N5O6 — CID 166747800
tert-butyl N-[4-[4-[2-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]ethynyl]piperidine-1-carbonyl]cyclohexyl]carbamate (PubChem CID 166747800) has the molecular formula C32H41N5O6 and a molecular weight of 591.71 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[2-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]ethynyl]piperidine-1-carbonyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[2-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]ethynyl]piperidine-1-carbonyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 166747800 |
| Molecular Formula | C32H41N5O6 |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.31 |
| IUPAC Name | tert-butyl N-[4-[4-[2-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]ethynyl]piperidine-1-carbonyl]cyclohexyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C#CC3CCN(C(=O)C4CCC(NC(=O)OC(C)(C)C)CC4)CC3)cc21 |
| InChI | InChI=1S/C32H41N5O6/c1-32(2,3)43-30(41)33-23-10-8-22(9-11-23)29(40)36-17-15-20(16-18-36)5-6-21-7-12-24-26(19-21)35(4)31(42)37(24)25-13-14-27(38)34-28(25)39/h7,12,19-20,22-23,25H,8-11,13-18H2,1-4H3,(H,33,41)(H,34,38,39) |
| InChIKey | GMPAJEXHQOXANT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|