C30H39N5O6 — CID 156860779
tert-butyl N-[4-[5-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]pent-4-ynylcarbamoyl]cyclohexyl]carbamate (PubChem CID 156860779) has the molecular formula C30H39N5O6 and a molecular weight of 565.67 g/mol. Its IUPAC name is tert-butyl N-[4-[5-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]pent-4-ynylcarbamoyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]pent-4-ynylcarbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 156860779 |
| Molecular Formula | C30H39N5O6 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.29 |
| IUPAC Name | tert-butyl N-[4-[5-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]pent-4-ynylcarbamoyl]cyclohexyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C#CCCCNC(=O)C3CCC(NC(=O)OC(C)(C)C)CC3)cc21 |
| InChI | InChI=1S/C30H39N5O6/c1-30(2,3)41-28(39)32-21-12-10-20(11-13-21)26(37)31-17-7-5-6-8-19-9-14-22-24(18-19)34(4)29(40)35(22)23-15-16-25(36)33-27(23)38/h9,14,18,20-21,23H,5,7,10-13,15-17H2,1-4H3,(H,31,37)(H,32,39)(H,33,36,38) |
| InChIKey | PMMXPWQLBLZIGF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|