C26H33N5O6 — CID 138694481
tert-butyl N-[[(2R)-4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]morpholin-2-yl]methyl]carbamate (PubChem CID 138694481) has the molecular formula C26H33N5O6 and a molecular weight of 511.58 g/mol. Its IUPAC name is tert-butyl N-[[(2R)-4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]morpholin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(2R)-4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]morpholin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 138694481 |
| Molecular Formula | C26H33N5O6 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | tert-butyl N-[[(2R)-4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]morpholin-2-yl]methyl]carbamate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C#CCN3CCO[C@H](CNC(=O)OC(C)(C)C)C3)cc21 |
| InChI | InChI=1S/C26H33N5O6/c1-26(2,3)37-24(34)27-15-18-16-30(12-13-36-18)11-5-6-17-7-8-19-21(14-17)29(4)25(35)31(19)20-9-10-22(32)28-23(20)33/h7-8,14,18,20H,9-13,15-16H2,1-4H3,(H,27,34)(H,28,32,33)/t18-,20?/m1/s1 |
| InChIKey | OBPDOHKMEQXFLI-QSVWIEALSA-N |
| XLogP | 0.89 |
| TPSA | 123.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|