C22H23N5O4 — CID 138694430
2-[(2R)-4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]morpholin-2-yl]acetonitrile (PubChem CID 138694430) has the molecular formula C22H23N5O4 and a molecular weight of 421.46 g/mol. Its IUPAC name is 2-[(2R)-4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]morpholin-2-yl]acetonitrile.
| Compound Name | 2-[(2R)-4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]morpholin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 138694430 |
| Molecular Formula | C22H23N5O4 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 2-[(2R)-4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]morpholin-2-yl]acetonitrile |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C#CCN3CCO[C@H](CC#N)C3)cc21 |
| InChI | InChI=1S/C22H23N5O4/c1-25-19-13-15(3-2-10-26-11-12-31-16(14-26)8-9-23)4-5-17(19)27(22(25)30)18-6-7-20(28)24-21(18)29/h4-5,13,16,18H,6-8,10-12,14H2,1H3,(H,24,28,29)/t16-,18?/m1/s1 |
| InChIKey | BYMBOXUXEUKJKL-PYUWXLGESA-N |
| XLogP | 0.28 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|