C23H27N5O5 — CID 175982956
[1-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]but-3-ynyl]piperidin-4-yl]carbamic acid (PubChem CID 175982956) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is [1-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]but-3-ynyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]but-3-ynyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 175982956 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | [1-[4-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]but-3-ynyl]piperidin-4-yl]carbamic acid |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C#CCCN3CCC(NC(=O)O)CC3)cc21 |
| InChI | InChI=1S/C23H27N5O5/c1-26-19-14-15(4-2-3-11-27-12-9-16(10-13-27)24-22(31)32)5-6-17(19)28(23(26)33)18-7-8-20(29)25-21(18)30/h5-6,14,16,18,24H,3,7-13H2,1H3,(H,31,32)(H,25,29,30) |
| InChIKey | DFADYJSSBDIOJZ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|