C26H32N4O6 — CID 146598368
tert-butyl 4-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methyl-2-oxobenzimidazol-5-yl]prop-2-ynoxy]piperidine-1-carboxylate (PubChem CID 146598368) has the molecular formula C26H32N4O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methyl-2-oxobenzimidazol-5-yl]prop-2-ynoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methyl-2-oxobenzimidazol-5-yl]prop-2-ynoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146598368 |
| Molecular Formula | C26H32N4O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | tert-butyl 4-[3-[3-(2,6-dioxopiperidin-3-yl)-1-methyl-2-oxobenzimidazol-5-yl]prop-2-ynoxy]piperidine-1-carboxylate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cc(C#CCOC3CCN(C(=O)OC(C)(C)C)CC3)ccc21 |
| InChI | InChI=1S/C26H32N4O6/c1-26(2,3)36-25(34)29-13-11-18(12-14-29)35-15-5-6-17-7-8-19-21(16-17)30(24(33)28(19)4)20-9-10-22(31)27-23(20)32/h7-8,16,18,20H,9-15H2,1-4H3,(H,27,31,32) |
| InChIKey | DDDFCNYJAQTITA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|