C26H32N4O5 — CID 155437728
tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]piperidine-1-carboxylate (PubChem CID 155437728) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155437728 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | tert-butyl 4-[3-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]prop-2-ynyl]piperidine-1-carboxylate |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C#CCC3CCN(C(=O)OC(C)(C)C)CC3)cc21 |
| InChI | InChI=1S/C26H32N4O5/c1-26(2,3)35-25(34)29-14-12-17(13-15-29)6-5-7-18-8-9-19-21(16-18)28(4)24(33)30(19)20-10-11-22(31)27-23(20)32/h8-9,16-17,20H,6,10-15H2,1-4H3,(H,27,31,32) |
| InChIKey | CVOZRYSUXYWKBX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|