C27H27N5O4 — CID 156860411
3-[5-[2-[1-(4-aminobenzoyl)piperidin-4-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 156860411) has the molecular formula C27H27N5O4 and a molecular weight of 485.54 g/mol. Its IUPAC name is 3-[5-[2-[1-(4-aminobenzoyl)piperidin-4-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[2-[1-(4-aminobenzoyl)piperidin-4-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156860411 |
| Molecular Formula | C27H27N5O4 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 3-[5-[2-[1-(4-aminobenzoyl)piperidin-4-yl]ethynyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(C#CC3CCN(C(=O)c4ccc(N)cc4)CC3)cc21 |
| InChI | InChI=1S/C27H27N5O4/c1-30-23-16-18(4-9-21(23)32(27(30)36)22-10-11-24(33)29-25(22)34)3-2-17-12-14-31(15-13-17)26(35)19-5-7-20(28)8-6-19/h4-9,16-17,22H,10-15,28H2,1H3,(H,29,33,34) |
| InChIKey | CMISPZFMLWSZOJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|