C34H39N5O6 — CID 168860245
2-methylpentan-2-yl N-[4-[4-[2-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]ethynyl]piperidine-1-carbonyl]phenyl]carbamate (PubChem CID 168860245) has the molecular formula C34H39N5O6 and a molecular weight of 613.72 g/mol. Its IUPAC name is 2-methylpentan-2-yl N-[4-[4-[2-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]ethynyl]piperidine-1-carbonyl]phenyl]carbamate.
| Compound Name | 2-methylpentan-2-yl N-[4-[4-[2-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]ethynyl]piperidine-1-carbonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 168860245 |
| Molecular Formula | C34H39N5O6 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | 2-methylpentan-2-yl N-[4-[4-[2-[1-(2,6-dioxopiperidin-3-yl)-3-methyl-2-oxobenzimidazol-5-yl]ethynyl]piperidine-1-carbonyl]phenyl]carbamate |
| SMILES | CCCC(C)(C)OC(=O)Nc1ccc(C(=O)N2CCC(C#Cc3ccc4c(c3)n(C)c(=O)n4C3CCC(=O)NC3=O)CC2)cc1 |
| InChI | InChI=1S/C34H39N5O6/c1-5-18-34(2,3)45-32(43)35-25-11-9-24(10-12-25)31(42)38-19-16-22(17-20-38)6-7-23-8-13-26-28(21-23)37(4)33(44)39(26)27-14-15-29(40)36-30(27)41/h8-13,21-22,27H,5,14-20H2,1-4H3,(H,35,43)(H,36,40,41) |
| InChIKey | FOMWDXTUORIKQU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 131.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|