C34H47N5O4 — CID 177198205
tert-butyl N-[4-[2-[4-[[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]methyl]piperidin-1-yl]ethyl]phenyl]carbamate (PubChem CID 177198205) has the molecular formula C34H47N5O4 and a molecular weight of 589.78 g/mol. Its IUPAC name is tert-butyl N-[4-[2-[4-[[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]methyl]piperidin-1-yl]ethyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-[4-[[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]methyl]piperidin-1-yl]ethyl]phenyl]carbamate |
|---|---|
| PubChem CID | 177198205 |
| Molecular Formula | C34H47N5O4 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.36 |
| IUPAC Name | tert-butyl N-[4-[2-[4-[[4-[4-(2,6-dioxopiperidin-3-yl)phenyl]piperazin-1-yl]methyl]piperidin-1-yl]ethyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(CCN2CCC(CN3CCN(c4ccc(C5CCC(=O)NC5=O)cc4)CC3)CC2)cc1 |
| InChI | InChI=1S/C34H47N5O4/c1-34(2,3)43-33(42)35-28-8-4-25(5-9-28)14-17-37-18-15-26(16-19-37)24-38-20-22-39(23-21-38)29-10-6-27(7-11-29)30-12-13-31(40)36-32(30)41/h4-11,26,30H,12-24H2,1-3H3,(H,35,42)(H,36,40,41) |
| InChIKey | QUDDKYHFQBKZIW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|