C26H39N5O4 — CID 171774165
tert-butyl 4-[[4-[5-[(3R)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]-1,4-diazepan-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 171774165) has the molecular formula C26H39N5O4 and a molecular weight of 485.63 g/mol. Its IUPAC name is tert-butyl 4-[[4-[5-[(3R)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]-1,4-diazepan-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[5-[(3R)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]-1,4-diazepan-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171774165 |
| Molecular Formula | C26H39N5O4 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | tert-butyl 4-[[4-[5-[(3R)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]-1,4-diazepan-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CCCN(c3ccc([C@H]4CCC(=O)NC4=O)cn3)CC2)CC1 |
| InChI | InChI=1S/C26H39N5O4/c1-26(2,3)35-25(34)31-13-9-19(10-14-31)18-29-11-4-12-30(16-15-29)22-7-5-20(17-27-22)21-6-8-23(32)28-24(21)33/h5,7,17,19,21H,4,6,8-16,18H2,1-3H3,(H,28,32,33)/t21-/m1/s1 |
| InChIKey | DDJRHCMLALTKMG-OAQYLSRUSA-N |
| XLogP | 2.76 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|