C20H31IN4O2 — CID 177363385
tert-butyl 4-[[4-(5-iodo-2-pyridinyl)piperazin-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 177363385) has the molecular formula C20H31IN4O2 and a molecular weight of 486.40 g/mol. Its IUPAC name is tert-butyl 4-[[4-(5-iodo-2-pyridinyl)piperazin-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(5-iodo-2-pyridinyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 177363385 |
| Molecular Formula | C20H31IN4O2 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | tert-butyl 4-[[4-(5-iodo-2-pyridinyl)piperazin-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CCN(c3ccc(I)cn3)CC2)CC1 |
| InChI | InChI=1S/C20H31IN4O2/c1-20(2,3)27-19(26)25-8-6-16(7-9-25)15-23-10-12-24(13-11-23)18-5-4-17(21)14-22-18/h4-5,14,16H,6-13,15H2,1-3H3 |
| InChIKey | UZTMPVGVZFNUBQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|