C19H30IN5O2 — CID 170276708
tert-butyl 4-[[3-(5-iodopyrimidin-2-yl)-1,3-diazinan-1-yl]methyl]piperidine-1-carboxylate (PubChem CID 170276708) has the molecular formula C19H30IN5O2 and a molecular weight of 487.39 g/mol. Its IUPAC name is tert-butyl 4-[[3-(5-iodopyrimidin-2-yl)-1,3-diazinan-1-yl]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[3-(5-iodopyrimidin-2-yl)-1,3-diazinan-1-yl]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 170276708 |
| Molecular Formula | C19H30IN5O2 |
| Molecular Weight | 487.39 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | tert-butyl 4-[[3-(5-iodopyrimidin-2-yl)-1,3-diazinan-1-yl]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CN2CCCN(c3ncc(I)cn3)C2)CC1 |
| InChI | InChI=1S/C19H30IN5O2/c1-19(2,3)27-18(26)24-9-5-15(6-10-24)13-23-7-4-8-25(14-23)17-21-11-16(20)12-22-17/h11-12,15H,4-10,13-14H2,1-3H3 |
| InChIKey | PQQMUJMNBYNJDG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|