C15H24IN3O2 — CID 166812304
tert-butyl 4-[(2-iodo-3-methylimidazol-4-yl)methyl]piperidine-1-carboxylate (PubChem CID 166812304) has the molecular formula C15H24IN3O2 and a molecular weight of 405.28 g/mol. Its IUPAC name is tert-butyl 4-[(2-iodo-3-methylimidazol-4-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-iodo-3-methylimidazol-4-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166812304 |
| Molecular Formula | C15H24IN3O2 |
| Molecular Weight | 405.28 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | tert-butyl 4-[(2-iodo-3-methylimidazol-4-yl)methyl]piperidine-1-carboxylate |
| SMILES | Cn1c(CC2CCN(C(=O)OC(C)(C)C)CC2)cnc1I |
| InChI | InChI=1S/C15H24IN3O2/c1-15(2,3)21-14(20)19-7-5-11(6-8-19)9-12-10-17-13(16)18(12)4/h10-11H,5-9H2,1-4H3 |
| InChIKey | YLXHXAZAFZVPCJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|