C14H20IN3O3 — CID 67529349
tert-butyl 4-(5-iodopyrimidin-2-yl)oxypiperidine-1-carboxylate (PubChem CID 67529349) has the molecular formula C14H20IN3O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is tert-butyl 4-(5-iodopyrimidin-2-yl)oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-iodopyrimidin-2-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 67529349 |
| Molecular Formula | C14H20IN3O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | tert-butyl 4-(5-iodopyrimidin-2-yl)oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ncc(I)cn2)CC1 |
| InChI | InChI=1S/C14H20IN3O3/c1-14(2,3)21-13(19)18-6-4-11(5-7-18)20-12-16-8-10(15)9-17-12/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | UBYQKNYTCNEOAS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|