C24H44N4O2 — CID 166113013
tert-butyl 4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidine-1-carboxylate;ethane (PubChem CID 166113013) has the molecular formula C24H44N4O2 and a molecular weight of 420.64 g/mol. Its IUPAC name is tert-butyl 4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 166113013 |
| Molecular Formula | C24H44N4O2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.35 |
| IUPAC Name | tert-butyl 4-[(4-pyridin-2-ylpiperazin-1-yl)methyl]piperidine-1-carboxylate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)N1CCC(CN2CCN(c3ccccn3)CC2)CC1 |
| InChI | InChI=1S/C20H32N4O2.2C2H6/c1-20(2,3)26-19(25)24-10-7-17(8-11-24)16-22-12-14-23(15-13-22)18-6-4-5-9-21-18;2*1-2/h4-6,9,17H,7-8,10-16H2,1-3H3;2*1-2H3 |
| InChIKey | IGEKYTWQSKCOQP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |