C21H29N3O4 — CID 172569961
tert-butyl 1-[5-[(3R)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]-4-methylpiperidine-4-carboxylate (PubChem CID 172569961) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl 1-[5-[(3R)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]-4-methylpiperidine-4-carboxylate.
| Compound Name | tert-butyl 1-[5-[(3R)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]-4-methylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 172569961 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl 1-[5-[(3R)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]-4-methylpiperidine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C)CCN(c2ccc([C@H]3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C21H29N3O4/c1-20(2,3)28-19(27)21(4)9-11-24(12-10-21)16-7-5-14(13-22-16)15-6-8-17(25)23-18(15)26/h5,7,13,15H,6,8-12H2,1-4H3,(H,23,25,26)/t15-/m1/s1 |
| InChIKey | JBJKQLKBEVYWNF-OAHLLOKOSA-N |
| XLogP | 2.55 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|