C23H34N4O2 — CID 167474741
3-[6-[4-[[cyclohexyl(methyl)amino]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione (PubChem CID 167474741) has the molecular formula C23H34N4O2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 3-[6-[4-[[cyclohexyl(methyl)amino]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-[[cyclohexyl(methyl)amino]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167474741 |
| Molecular Formula | C23H34N4O2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | 3-[6-[4-[[cyclohexyl(methyl)amino]methyl]piperidin-1-yl]-3-pyridinyl]piperidine-2,6-dione |
| SMILES | CN(CC1CCN(c2ccc(C3CCC(=O)NC3=O)cn2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C23H34N4O2/c1-26(19-5-3-2-4-6-19)16-17-11-13-27(14-12-17)21-9-7-18(15-24-21)20-8-10-22(28)25-23(20)29/h7,9,15,17,19-20H,2-6,8,10-14,16H2,1H3,(H,25,28,29) |
| InChIKey | LHDKVYMDQKKDON-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|