C22H31N5O3 — CID 174216532
N-[1-[5-[(3S)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]piperidin-4-yl]-N-methylpiperidine-4-carboxamide (PubChem CID 174216532) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[1-[5-[(3S)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]piperidin-4-yl]-N-methylpiperidine-4-carboxamide.
| Compound Name | N-[1-[5-[(3S)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]piperidin-4-yl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 174216532 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | N-[1-[5-[(3S)-2,6-dioxopiperidin-3-yl]-2-pyridinyl]piperidin-4-yl]-N-methylpiperidine-4-carboxamide |
| SMILES | CN(C(=O)C1CCNCC1)C1CCN(c2ccc([C@@H]3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C22H31N5O3/c1-26(22(30)15-6-10-23-11-7-15)17-8-12-27(13-9-17)19-4-2-16(14-24-19)18-3-5-20(28)25-21(18)29/h2,4,14-15,17-18,23H,3,5-13H2,1H3,(H,25,28,29)/t18-/m0/s1 |
| InChIKey | XROFQIVOPGDQLR-SFHVURJKSA-N |
| XLogP | 1.03 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|