C22H32N4O4 — CID 170770822
tert-butyl 3-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperazin-1-yl]propanoate (PubChem CID 170770822) has the molecular formula C22H32N4O4 and a molecular weight of 416.52 g/mol. Its IUPAC name is tert-butyl 3-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperazin-1-yl]propanoate.
| Compound Name | tert-butyl 3-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 170770822 |
| Molecular Formula | C22H32N4O4 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | tert-butyl 3-[4-[4-[(2,6-dioxopiperidin-3-yl)amino]phenyl]piperazin-1-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCN1CCN(c2ccc(NC3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C22H32N4O4/c1-22(2,3)30-20(28)10-11-25-12-14-26(15-13-25)17-6-4-16(5-7-17)23-18-8-9-19(27)24-21(18)29/h4-7,18,23H,8-15H2,1-3H3,(H,24,27,29) |
| InChIKey | JJVJFOWNEGVUGE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|