C29H34N4O6 — CID 155677835
tert-butyl 2-[4-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]acetate (PubChem CID 155677835) has the molecular formula C29H34N4O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is tert-butyl 2-[4-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 155677835 |
| Molecular Formula | C29H34N4O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | tert-butyl 2-[4-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC(N2CC(C#Cc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)CC1 |
| InChI | InChI=1S/C29H34N4O6/c1-29(2,3)39-25(35)17-31-12-10-20(11-13-31)32-15-19(16-32)5-4-18-6-7-21-22(14-18)28(38)33(27(21)37)23-8-9-24(34)30-26(23)36/h6-7,14,19-20,23H,8-13,15-17H2,1-3H3,(H,30,34,36) |
| InChIKey | FOONCOJYAFWVMX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|