C21H19F3N4O7 — CID 162482472
[2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 162482472) has the molecular formula C21H19F3N4O7 and a molecular weight of 496.40 g/mol. Its IUPAC name is [2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162482472 |
| Molecular Formula | C21H19F3N4O7 |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [2-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(CC(=O)OC(=O)C(F)(F)F)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H19F3N4O7/c22-21(23,24)20(34)35-16(30)10-26-5-7-27(8-6-26)11-1-2-12-13(9-11)19(33)28(18(12)32)14-3-4-15(29)25-17(14)31/h1-2,9,14H,3-8,10H2,(H,25,29,31) |
| InChIKey | BFTDQQYPUXLWAV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|