C24H23F3N4O7 — CID 162482484
[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2,7-diazaspiro[3.5]nonan-7-yl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 162482484) has the molecular formula C24H23F3N4O7 and a molecular weight of 536.46 g/mol. Its IUPAC name is [2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2,7-diazaspiro[3.5]nonan-7-yl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2,7-diazaspiro[3.5]nonan-7-yl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162482484 |
| Molecular Formula | C24H23F3N4O7 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | [2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2,7-diazaspiro[3.5]nonan-7-yl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CC5(CCN(CC(=O)OC(=O)C(F)(F)F)CC5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H23F3N4O7/c25-24(26,27)22(37)38-18(33)10-29-7-5-23(6-8-29)11-30(12-23)13-1-2-14-15(9-13)21(36)31(20(14)35)16-3-4-17(32)28-19(16)34/h1-2,9,16H,3-8,10-12H2,(H,28,32,34) |
| InChIKey | BWVLKJNTRRMYNZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|