C29H33N3O6 — CID 155677762
tert-butyl 2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]-7-azaspiro[3.5]nonan-7-yl]acetate (PubChem CID 155677762) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]-7-azaspiro[3.5]nonan-7-yl]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]-7-azaspiro[3.5]nonan-7-yl]acetate |
|---|---|
| PubChem CID | 155677762 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]-7-azaspiro[3.5]nonan-7-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCC2(CC1)CC(C#Cc1ccc3c(c1)C(=O)N(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C29H33N3O6/c1-28(2,3)38-24(34)17-31-12-10-29(11-13-31)15-19(16-29)5-4-18-6-7-20-21(14-18)27(37)32(26(20)36)22-8-9-23(33)30-25(22)35/h6-7,14,19,22H,8-13,15-17H2,1-3H3,(H,30,33,35) |
| InChIKey | LRRUYQDNPCJETI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|