C25H26N4O6 — CID 156635128
2-[4-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]acetic acid (PubChem CID 156635128) has the molecular formula C25H26N4O6 and a molecular weight of 478.51 g/mol. Its IUPAC name is 2-[4-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 156635128 |
| Molecular Formula | C25H26N4O6 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[4-[3-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]ethynyl]azetidin-1-yl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(N2CC(C#Cc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)CC1 |
| InChI | InChI=1S/C25H26N4O6/c30-21-6-5-20(23(33)26-21)29-24(34)18-4-3-15(11-19(18)25(29)35)1-2-16-12-28(13-16)17-7-9-27(10-8-17)14-22(31)32/h3-4,11,16-17,20H,5-10,12-14H2,(H,31,32)(H,26,30,33) |
| InChIKey | KNFOOQDSWJPXNK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|