C30H30F3N7O7 — CID 175455016
(2,2,2-trifluoroacetyl) 6-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]methyl]piperidin-1-yl]pyridazine-3-carboxylate (PubChem CID 175455016) has the molecular formula C30H30F3N7O7 and a molecular weight of 657.61 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 6-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]methyl]piperidin-1-yl]pyridazine-3-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 6-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]methyl]piperidin-1-yl]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 175455016 |
| Molecular Formula | C30H30F3N7O7 |
| Molecular Weight | 657.61 g/mol |
| Exact Mass | 657.22 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 6-[4-[[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]piperazin-1-yl]methyl]piperidin-1-yl]pyridazine-3-carboxylate |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(CC5CCN(c6ccc(C(=O)OC(=O)C(F)(F)F)nn6)CC5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H30F3N7O7/c31-30(32,33)29(46)47-28(45)21-3-5-23(36-35-21)39-9-7-17(8-10-39)16-37-11-13-38(14-12-37)18-1-2-19-20(15-18)27(44)40(26(19)43)22-4-6-24(41)34-25(22)42/h1-3,5,15,17,22H,4,6-14,16H2,(H,34,41,42) |
| InChIKey | FKZPEJQVNAEMTK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.61 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|