C31H38N6O5 — CID 164853469
5-[4-[[4-(4-amino-5-methoxy-2-methylphenyl)piperazin-1-yl]methyl]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 164853469) has the molecular formula C31H38N6O5 and a molecular weight of 574.68 g/mol. Its IUPAC name is 5-[4-[[4-(4-amino-5-methoxy-2-methylphenyl)piperazin-1-yl]methyl]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[4-[[4-(4-amino-5-methoxy-2-methylphenyl)piperazin-1-yl]methyl]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 164853469 |
| Molecular Formula | C31H38N6O5 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.29 |
| IUPAC Name | 5-[4-[[4-(4-amino-5-methoxy-2-methylphenyl)piperazin-1-yl]methyl]piperidin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | COc1cc(N2CCN(CC3CCN(c4ccc5c(c4)C(=O)N(C4CCC(=O)NC4=O)C5=O)CC3)CC2)c(C)cc1N |
| InChI | InChI=1S/C31H38N6O5/c1-19-15-24(32)27(42-2)17-26(19)36-13-11-34(12-14-36)18-20-7-9-35(10-8-20)21-3-4-22-23(16-21)31(41)37(30(22)40)25-5-6-28(38)33-29(25)39/h3-4,15-17,20,25H,5-14,18,32H2,1-2H3,(H,33,38,39) |
| InChIKey | JIYVHWVLJQLICF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|