C30H41N5O5 — CID 165136505
2-(2,6-dioxopiperidin-3-yl)-5-[4-[[4-(piperidin-4-ylmethoxy)cyclohexyl]methyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 165136505) has the molecular formula C30H41N5O5 and a molecular weight of 551.69 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[4-(piperidin-4-ylmethoxy)cyclohexyl]methyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[4-(piperidin-4-ylmethoxy)cyclohexyl]methyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 165136505 |
| Molecular Formula | C30H41N5O5 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.31 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[[4-(piperidin-4-ylmethoxy)cyclohexyl]methyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(CC5CCC(OCC6CCNCC6)CC5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H41N5O5/c36-27-8-7-26(28(37)32-27)35-29(38)24-6-3-22(17-25(24)30(35)39)34-15-13-33(14-16-34)18-20-1-4-23(5-2-20)40-19-21-9-11-31-12-10-21/h3,6,17,20-21,23,26,31H,1-2,4-5,7-16,18-19H2,(H,32,36,37) |
| InChIKey | BFOATHZGFWLHNU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|