C21H29Cl2N5O4 — CID 166428469
5-[4-(4-aminobutyl)piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrochloride (PubChem CID 166428469) has the molecular formula C21H29Cl2N5O4 and a molecular weight of 486.40 g/mol. Its IUPAC name is 5-[4-(4-aminobutyl)piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrochloride.
| Compound Name | 5-[4-(4-aminobutyl)piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 166428469 |
| Molecular Formula | C21H29Cl2N5O4 |
| Molecular Weight | 486.40 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | 5-[4-(4-aminobutyl)piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione;dihydrochloride |
| SMILES | Cl.Cl.NCCCCN1CCN(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C21H27N5O4.2ClH/c22-7-1-2-8-24-9-11-25(12-10-24)14-3-4-15-16(13-14)21(30)26(20(15)29)17-5-6-18(27)23-19(17)28;;/h3-4,13,17H,1-2,5-12,22H2,(H,23,27,28);2*1H |
| InChIKey | NBQBPJUYKOADPU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 116.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|