C24H30N4O4 — CID 176967673
2-(2,6-dioxopiperidin-3-yl)-5-(4-hept-6-enylpiperazin-1-yl)isoindole-1,3-dione (PubChem CID 176967673) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-(4-hept-6-enylpiperazin-1-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-(4-hept-6-enylpiperazin-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 176967673 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-(4-hept-6-enylpiperazin-1-yl)isoindole-1,3-dione |
| SMILES | C=CCCCCCN1CCN(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C24H30N4O4/c1-2-3-4-5-6-11-26-12-14-27(15-13-26)17-7-8-18-19(16-17)24(32)28(23(18)31)20-9-10-21(29)25-22(20)30/h2,7-8,16,20H,1,3-6,9-15H2,(H,25,29,30) |
| InChIKey | LXHCKAFWFNDJIQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|