C31H37BrN4O8 — CID 135147055
5-[4-[2-[2-[2-[2-(4-bromophenoxy)ethoxy]ethoxy]ethoxy]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 135147055) has the molecular formula C31H37BrN4O8 and a molecular weight of 673.56 g/mol. Its IUPAC name is 5-[4-[2-[2-[2-[2-(4-bromophenoxy)ethoxy]ethoxy]ethoxy]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[4-[2-[2-[2-[2-(4-bromophenoxy)ethoxy]ethoxy]ethoxy]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 135147055 |
| Molecular Formula | C31H37BrN4O8 |
| Molecular Weight | 673.56 g/mol |
| Exact Mass | 672.18 |
| IUPAC Name | 5-[4-[2-[2-[2-[2-(4-bromophenoxy)ethoxy]ethoxy]ethoxy]ethyl]piperazin-1-yl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(CCOCCOCCOCCOc5ccc(Br)cc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H37BrN4O8/c32-22-1-4-24(5-2-22)44-20-19-43-18-17-42-16-15-41-14-13-34-9-11-35(12-10-34)23-3-6-25-26(21-23)31(40)36(30(25)39)27-7-8-28(37)33-29(27)38/h1-6,21,27H,7-20H2,(H,33,37,38) |
| InChIKey | QLYFPSCNHDBGBM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.56 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|