C30H34N6O5 — CID 175658749
1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-N-[(2-piperazin-1-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 175658749) has the molecular formula C30H34N6O5 and a molecular weight of 558.64 g/mol. Its IUPAC name is 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-N-[(2-piperazin-1-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-N-[(2-piperazin-1-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 175658749 |
| Molecular Formula | C30H34N6O5 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-N-[(2-piperazin-1-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCC(C(=O)NCc5ccccc5N5CCNCC5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H34N6O5/c37-26-8-7-25(28(39)33-26)36-29(40)22-6-5-21(17-23(22)30(36)41)34-13-9-19(10-14-34)27(38)32-18-20-3-1-2-4-24(20)35-15-11-31-12-16-35/h1-6,17,19,25,31H,7-16,18H2,(H,32,38)(H,33,37,39) |
| InChIKey | QJPJQNKRGVWEEL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 131.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|