C13H14N2O3W — CID 171627444
[(2E)-2-[(4E)-1-(2,6-dioxopiperidin-3-yl)-4-ethylidene-2-oxopyrrolidin-3-ylidene]ethylidene]tungsten (PubChem CID 171627444) has the molecular formula C13H14N2O3W and a molecular weight of 430.11 g/mol. Its IUPAC name is [(2E)-2-[(4E)-1-(2,6-dioxopiperidin-3-yl)-4-ethylidene-2-oxopyrrolidin-3-ylidene]ethylidene]tungsten.
| Compound Name | [(2E)-2-[(4E)-1-(2,6-dioxopiperidin-3-yl)-4-ethylidene-2-oxopyrrolidin-3-ylidene]ethylidene]tungsten |
|---|---|
| PubChem CID | 171627444 |
| Molecular Formula | C13H14N2O3W |
| Molecular Weight | 430.11 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | [(2E)-2-[(4E)-1-(2,6-dioxopiperidin-3-yl)-4-ethylidene-2-oxopyrrolidin-3-ylidene]ethylidene]tungsten |
| SMILES | C/C=C1/CN(C2CCC(=O)NC2=O)C(=O)/C1=C/C=[W] |
| InChI | InChI=1S/C13H14N2O3.W/c1-3-8-7-15(13(18)9(8)4-2)10-5-6-11(16)14-12(10)17;/h2-4,10H,5-7H2,1H3,(H,14,16,17);/b8-3-,9-4+; |
| InChIKey | BMFLCESBUPSTAE-FGZDIQTJSA-N |
| XLogP | -0.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.11 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|