C22H25FN4O3 — CID 166797558
3-[(3E,4Z)-3-[(Z)-but-2-enylidene]-4-[[[2-fluoro-4-(methylamino)phenyl]methylamino]methylidene]-2-oxopyrrolidin-1-yl]piperidine-2,6-dione (PubChem CID 166797558) has the molecular formula C22H25FN4O3 and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-[(3E,4Z)-3-[(Z)-but-2-enylidene]-4-[[[2-fluoro-4-(methylamino)phenyl]methylamino]methylidene]-2-oxopyrrolidin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[(3E,4Z)-3-[(Z)-but-2-enylidene]-4-[[[2-fluoro-4-(methylamino)phenyl]methylamino]methylidene]-2-oxopyrrolidin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166797558 |
| Molecular Formula | C22H25FN4O3 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-[(3E,4Z)-3-[(Z)-but-2-enylidene]-4-[[[2-fluoro-4-(methylamino)phenyl]methylamino]methylidene]-2-oxopyrrolidin-1-yl]piperidine-2,6-dione |
| SMILES | C/C=C\C=C1\C(=O)N(C2CCC(=O)NC2=O)C\C1=C/NCc1ccc(NC)cc1F |
| InChI | InChI=1S/C22H25FN4O3/c1-3-4-5-17-15(12-25-11-14-6-7-16(24-2)10-18(14)23)13-27(22(17)30)19-8-9-20(28)26-21(19)29/h3-7,10,12,19,24-25H,8-9,11,13H2,1-2H3,(H,26,28,29)/b4-3-,15-12+,17-5+ |
| InChIKey | GYPUAQOKMMMGMB-JHAFRKSLSA-N |
| XLogP | 1.99 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|