C17H24N2O3 — CID 176988345
acetylene;ethane;3-(4-ethenyl-3-ethyl-5-oxo-2H-pyrrol-1-yl)piperidine-2,6-dione (PubChem CID 176988345) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is acetylene;ethane;3-(4-ethenyl-3-ethyl-5-oxo-2H-pyrrol-1-yl)piperidine-2,6-dione.
| Compound Name | acetylene;ethane;3-(4-ethenyl-3-ethyl-5-oxo-2H-pyrrol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176988345 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | acetylene;ethane;3-(4-ethenyl-3-ethyl-5-oxo-2H-pyrrol-1-yl)piperidine-2,6-dione |
| SMILES | C#C.C=CC1=C(CC)CN(C2CCC(=O)NC2=O)C1=O.CC |
| InChI | InChI=1S/C13H16N2O3.C2H6.C2H2/c1-3-8-7-15(13(18)9(8)4-2)10-5-6-11(16)14-12(10)17;2*1-2/h4,10H,2-3,5-7H2,1H3,(H,14,16,17);1-2H3;1-2H |
| InChIKey | JVGGZXFUZINOPX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|