C13H18N2O2 — CID 176988089
3-(5-ethenyl-4-ethyl-2,3-dihydropyrrol-1-yl)piperidine-2,6-dione (PubChem CID 176988089) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 3-(5-ethenyl-4-ethyl-2,3-dihydropyrrol-1-yl)piperidine-2,6-dione.
| Compound Name | 3-(5-ethenyl-4-ethyl-2,3-dihydropyrrol-1-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 176988089 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-(5-ethenyl-4-ethyl-2,3-dihydropyrrol-1-yl)piperidine-2,6-dione |
| SMILES | C=CC1=C(CC)CCN1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H18N2O2/c1-3-9-7-8-15(10(9)4-2)11-5-6-12(16)14-13(11)17/h4,11H,2-3,5-8H2,1H3,(H,14,16,17) |
| InChIKey | UGYRKDCRTWTMMT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|