C15H23N3O2 — CID 177338862
3-[(2E,3E)-3-ethylidene-4-methyl-2-propylidenepiperazin-1-yl]piperidine-2,6-dione (PubChem CID 177338862) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-[(2E,3E)-3-ethylidene-4-methyl-2-propylidenepiperazin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[(2E,3E)-3-ethylidene-4-methyl-2-propylidenepiperazin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177338862 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3-[(2E,3E)-3-ethylidene-4-methyl-2-propylidenepiperazin-1-yl]piperidine-2,6-dione |
| SMILES | C/C=C1C(=C/CC)\N(C2CCC(=O)NC2=O)CCN\1C |
| InChI | InChI=1S/C15H23N3O2/c1-4-6-12-11(5-2)17(3)9-10-18(12)13-7-8-14(19)16-15(13)20/h5-6,13H,4,7-10H2,1-3H3,(H,16,19,20)/b11-5+,12-6+ |
| InChIKey | OBBJIRHKNIBYKP-YDWXAUTNSA-N |
| XLogP | 1.24 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|