C19H31N3O2 — CID 177339089
ethane;methane;3-[(2E,3E)-4-methyl-2,3-bis(prop-2-enylidene)piperazin-1-yl]piperidine-2,6-dione (PubChem CID 177339089) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is ethane;methane;3-[(2E,3E)-4-methyl-2,3-bis(prop-2-enylidene)piperazin-1-yl]piperidine-2,6-dione.
| Compound Name | ethane;methane;3-[(2E,3E)-4-methyl-2,3-bis(prop-2-enylidene)piperazin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177339089 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | ethane;methane;3-[(2E,3E)-4-methyl-2,3-bis(prop-2-enylidene)piperazin-1-yl]piperidine-2,6-dione |
| SMILES | C.C=C/C=C1C(=C/C=C)\N(C2CCC(=O)NC2=O)CCN\1C.CC |
| InChI | InChI=1S/C16H21N3O2.C2H6.CH4/c1-4-6-12-13(7-5-2)19(11-10-18(12)3)14-8-9-15(20)17-16(14)21;1-2;/h4-7,14H,1-2,8-11H2,3H3,(H,17,20,21);1-2H3;1H4/b12-6+,13-7+;; |
| InChIKey | SMWBLRMBOJPGAK-ATFITULDSA-N |
| XLogP | 2.84 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|