C16H25N3O2 — CID 177343937
ethane;3-[(2E,3E)-3-ethylidene-2-prop-2-enylidenepiperazin-1-yl]piperidine-2,6-dione (PubChem CID 177343937) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is ethane;3-[(2E,3E)-3-ethylidene-2-prop-2-enylidenepiperazin-1-yl]piperidine-2,6-dione.
| Compound Name | ethane;3-[(2E,3E)-3-ethylidene-2-prop-2-enylidenepiperazin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177343937 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | ethane;3-[(2E,3E)-3-ethylidene-2-prop-2-enylidenepiperazin-1-yl]piperidine-2,6-dione |
| SMILES | C=C/C=C1C(=C/C)\NCCN\1C1CCC(=O)NC1=O.CC |
| InChI | InChI=1S/C14H19N3O2.C2H6/c1-3-5-11-10(4-2)15-8-9-17(11)12-6-7-13(18)16-14(12)19;1-2/h3-5,12,15H,1,6-9H2,2H3,(H,16,18,19);1-2H3/b10-4+,11-5+; |
| InChIKey | NMWRMCWVKATCAO-DVHWKNMOSA-N |
| XLogP | 1.70 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|