C13H17N3O3 — CID 156799097
3-[3,4-dimethyl-2-oxo-5-[(Z)-prop-1-enyl]imidazol-1-yl]piperidine-2,6-dione (PubChem CID 156799097) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-[3,4-dimethyl-2-oxo-5-[(Z)-prop-1-enyl]imidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3,4-dimethyl-2-oxo-5-[(Z)-prop-1-enyl]imidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156799097 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-[3,4-dimethyl-2-oxo-5-[(Z)-prop-1-enyl]imidazol-1-yl]piperidine-2,6-dione |
| SMILES | C/C=C\c1c(C)n(C)c(=O)n1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C13H17N3O3/c1-4-5-9-8(2)15(3)13(19)16(9)10-6-7-11(17)14-12(10)18/h4-5,10H,6-7H2,1-3H3,(H,14,17,18)/b5-4- |
| InChIKey | OQEVMUSSNGCLOM-PLNGDYQASA-N |
| XLogP | 0.51 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|