C14H18N4O3 — CID 177240420
(3S)-3-[4-[(E)-1-aminoprop-1-enyl]-5-ethenyl-3-methyl-2-oxoimidazol-1-yl]piperidine-2,6-dione (PubChem CID 177240420) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is (3S)-3-[4-[(E)-1-aminoprop-1-enyl]-5-ethenyl-3-methyl-2-oxoimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[4-[(E)-1-aminoprop-1-enyl]-5-ethenyl-3-methyl-2-oxoimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177240420 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (3S)-3-[4-[(E)-1-aminoprop-1-enyl]-5-ethenyl-3-methyl-2-oxoimidazol-1-yl]piperidine-2,6-dione |
| SMILES | C=Cc1c(/C(N)=C\C)n(C)c(=O)n1[C@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C14H18N4O3/c1-4-8(15)12-9(5-2)18(14(21)17(12)3)10-6-7-11(19)16-13(10)20/h4-5,10H,2,6-7,15H2,1,3H3,(H,16,19,20)/b8-4+/t10-/m0/s1 |
| InChIKey | LISADQATZKQGAL-GOJXHPMJSA-N |
| XLogP | 0.13 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|