C12H13N3O3 — CID 170983752
N-[6-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]acetamide (PubChem CID 170983752) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is N-[6-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]acetamide.
| Compound Name | N-[6-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 170983752 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-[6-(2,6-dioxopiperidin-3-yl)-3-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2CCC(=O)NC2=O)nc1 |
| InChI | InChI=1S/C12H13N3O3/c1-7(16)14-8-2-4-10(13-6-8)9-3-5-11(17)15-12(9)18/h2,4,6,9H,3,5H2,1H3,(H,14,16)(H,15,17,18) |
| InChIKey | SNICOOFCPMOAFZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|