C14H15N3O3 — CID 171730681
2-[(3S)-2,6-dioxopiperidin-3-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine-7-carboxamide (PubChem CID 171730681) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-[(3S)-2,6-dioxopiperidin-3-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine-7-carboxamide.
| Compound Name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 171730681 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[(3S)-2,6-dioxopiperidin-3-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine-7-carboxamide |
| SMILES | NC(=O)C1CCc2ccc([C@@H]3CCC(=O)NC3=O)nc21 |
| InChI | InChI=1S/C14H15N3O3/c15-13(19)9-3-1-7-2-5-10(16-12(7)9)8-4-6-11(18)17-14(8)20/h2,5,8-9H,1,3-4,6H2,(H2,15,19)(H,17,18,20)/t8-,9?/m0/s1 |
| InChIKey | MFGMDVQECOTFPD-IENPIDJESA-N |
| XLogP | 0.12 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|