C6H7NO4 — CID 92974822
(3R)-2,6-dioxopiperidine-3-carboxylic acid (PubChem CID 92974822) has the molecular formula C6H7NO4 and a molecular weight of 157.12 g/mol. Its IUPAC name is (3R)-2,6-dioxopiperidine-3-carboxylic acid.
| Compound Name | (3R)-2,6-dioxopiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 92974822 |
| Molecular Formula | C6H7NO4 |
| Molecular Weight | 157.12 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | (3R)-2,6-dioxopiperidine-3-carboxylic acid |
| SMILES | O=C1CC[C@@H](C(=O)O)C(=O)N1 |
| InChI | InChI=1S/C6H7NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h3H,1-2H2,(H,10,11)(H,7,8,9)/t3-/m1/s1 |
| InChIKey | MHCDUOFVNOMAGZ-GSVOUGTGSA-N |
| XLogP | -0.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.12 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|