(3R)-2,6-dioxopiperidine-3-carboxylic acid

C6H7NO4 — CID 92974822

IUPAC(3R)-2,6-dioxopiperidine-3-carboxylic acid
SMILESO=C1CC[C@@H](C(=O)O)C(=O)N1
InChIInChI=1S/C6H7NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h3H,1-2H2,(H,10,11)(H,7,8,9)/t3-/m1/s1
InChIKeyMHCDUOFVNOMAGZ-GSVOUGTGSA-N
MW157.12 g/mol
LogP-0.88
Rot. Bonds1

About (3R)-2,6-dioxopiperidine-3-carboxylic acid

(3R)-2,6-dioxopiperidine-3-carboxylic acid (PubChem CID 92974822) has the molecular formula C6H7NO4 and a molecular weight of 157.12 g/mol. Its IUPAC name is (3R)-2,6-dioxopiperidine-3-carboxylic acid.

Molecular Properties

Compound Name(3R)-2,6-dioxopiperidine-3-carboxylic acid
PubChem CID92974822
Molecular FormulaC6H7NO4
Molecular Weight157.12 g/mol
Exact Mass157.04
IUPAC Name(3R)-2,6-dioxopiperidine-3-carboxylic acid
SMILESO=C1CC[C@@H](C(=O)O)C(=O)N1
InChIInChI=1S/C6H7NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h3H,1-2H2,(H,10,11)(H,7,8,9)/t3-/m1/s1
InChIKeyMHCDUOFVNOMAGZ-GSVOUGTGSA-N
XLogP-0.88
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.12
LogP ≤ 5-0.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze (3R)-2,6-dioxopiperidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-2,6-dioxopiperidine-3-carboxylic acid?
The IUPAC name of (3R)-2,6-dioxopiperidine-3-carboxylic acid (CID 92974822) is (3R)-2,6-dioxopiperidine-3-carboxylic acid.
What is the SMILES notation for (3R)-2,6-dioxopiperidine-3-carboxylic acid?
The canonical SMILES for (3R)-2,6-dioxopiperidine-3-carboxylic acid is O=C1CC[C@@H](C(=O)O)C(=O)N1.
What is the InChIKey of (3R)-2,6-dioxopiperidine-3-carboxylic acid?
The InChIKey is MHCDUOFVNOMAGZ-GSVOUGTGSA-N. The full InChI is InChI=1S/C6H7NO4/c8-4-2-1-3(6(10)11)5(9)7-4/h3H,1-2H2,(H,10,11)(H,7,8,9)/t3-/m1/s1.
What are the key properties of (3R)-2,6-dioxopiperidine-3-carboxylic acid?
(3R)-2,6-dioxopiperidine-3-carboxylic acid has a molecular weight of 157.12 g/mol, XLogP of -0.88, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,6-dioxopiperidine-3-carboxylic acid is sourced from PubChem (CID 92974822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).